Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Tellurium, 99.8%, (trace metal basis), powder, -200 mesh
CAS: 13494-80-9 Molecular Formula: Te Molecular Weight (g/mol): 127.60 MDL Number: MFCD00134062 InChI Key: PORWMNRCUJJQNO-UHFFFAOYSA-N Synonym: tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds PubChem CID: 6327182 ChEBI: CHEBI:30452 IUPAC Name: tellurium SMILES: [Te]
| PubChem CID | 6327182 |
|---|---|
| CAS | 13494-80-9 |
| Molecular Weight (g/mol) | 127.60 |
| ChEBI | CHEBI:30452 |
| MDL Number | MFCD00134062 |
| SMILES | [Te] |
| Synonym | tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds |
| IUPAC Name | tellurium |
| InChI Key | PORWMNRCUJJQNO-UHFFFAOYSA-N |
| Molecular Formula | Te |
Copper, 99+%, turnings
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Triethoxysilane, 96%
CAS: 998-30-1 Molecular Formula: C6H15O3Si Molecular Weight (g/mol): 163.268 MDL Number: MFCD00009061 InChI Key: PKDCQJMRWCHQOH-UHFFFAOYSA-N Synonym: triethoxysilane,silane, triethoxy,unii-8t460wdh89,c6h16o3si,si oet 3h;,c2h5o 3sih,4-01-00-01359 beilstein handbook reference,triethoxysilane 10g,triethoxysilyl modified poly 1,2-butadiene,poly 1,2-butadiene , triethoxysilyl modified PubChem CID: 6327710 IUPAC Name: triethoxysilicon SMILES: CCO[Si](OCC)OCC
| PubChem CID | 6327710 |
|---|---|
| CAS | 998-30-1 |
| Molecular Weight (g/mol) | 163.268 |
| MDL Number | MFCD00009061 |
| SMILES | CCO[Si](OCC)OCC |
| Synonym | triethoxysilane,silane, triethoxy,unii-8t460wdh89,c6h16o3si,si oet 3h;,c2h5o 3sih,4-01-00-01359 beilstein handbook reference,triethoxysilane 10g,triethoxysilyl modified poly 1,2-butadiene,poly 1,2-butadiene , triethoxysilyl modified |
| IUPAC Name | triethoxysilicon |
| InChI Key | PKDCQJMRWCHQOH-UHFFFAOYSA-N |
| Molecular Formula | C6H15O3Si |
Sodium hydrogen tartrate, 98+%, for analysis
CAS: 526-94-3 Molecular Formula: C4H5NaO6 Molecular Weight (g/mol): 172.07 MDL Number: MFCD00065393,MFCD00065393 InChI Key: NKAAEMMYHLFEFN-UHFFFAOYNA-M Synonym: sodium bitartrate,monosodium tartrate,sodium hydrogen tartrate,natriumtartrat german,sodium 3-carboxy-2,3-dihydroxypropanoate,monobasic sodium tartrate,monosodium l-+-tartrate,tartaric acid, monosodium salt,natrium hydrogen-2r,3r-tartrat,weinstein PubChem CID: 23690454 IUPAC Name: sodium;2,3,4-trihydroxy-4-oxobutanoate SMILES: [Na+].OC(C(O)C([O-])=O)C(O)=O
| PubChem CID | 23690454 |
|---|---|
| CAS | 526-94-3 |
| Molecular Weight (g/mol) | 172.07 |
| MDL Number | MFCD00065393,MFCD00065393 |
| SMILES | [Na+].OC(C(O)C([O-])=O)C(O)=O |
| Synonym | sodium bitartrate,monosodium tartrate,sodium hydrogen tartrate,natriumtartrat german,sodium 3-carboxy-2,3-dihydroxypropanoate,monobasic sodium tartrate,monosodium l-+-tartrate,tartaric acid, monosodium salt,natrium hydrogen-2r,3r-tartrat,weinstein |
| IUPAC Name | sodium;2,3,4-trihydroxy-4-oxobutanoate |
| InChI Key | NKAAEMMYHLFEFN-UHFFFAOYNA-M |
| Molecular Formula | C4H5NaO6 |
Barium peroxide, 95%
CAS: 1304-29-6 Molecular Formula: BaO2 Molecular Weight (g/mol): 169.33 MDL Number: MFCD00003454 InChI Key: ZJRXSAYFZMGQFP-UHFFFAOYSA-N Synonym: barium peroxide,barium dioxide,barium binoxide,barium superoxide,barium oxide, per,bario perossido di,bariumperoxid german,bariumperoxyde dutch,dioxyde de baryum french,barium peroxide ba o2 PubChem CID: 14773 IUPAC Name: barium(2+);peroxide SMILES: [O-][O-].[Ba+2]
| PubChem CID | 14773 |
|---|---|
| CAS | 1304-29-6 |
| Molecular Weight (g/mol) | 169.33 |
| MDL Number | MFCD00003454 |
| SMILES | [O-][O-].[Ba+2] |
| Synonym | barium peroxide,barium dioxide,barium binoxide,barium superoxide,barium oxide, per,bario perossido di,bariumperoxid german,bariumperoxyde dutch,dioxyde de baryum french,barium peroxide ba o2 |
| IUPAC Name | barium(2+);peroxide |
| InChI Key | ZJRXSAYFZMGQFP-UHFFFAOYSA-N |
| Molecular Formula | BaO2 |
Sodium chlorate, ACS, 99.0% min
CAS: 7775-09-9 Molecular Formula: ClNaO3 Molecular Weight (g/mol): 106.44 MDL Number: MFCD00003479 InChI Key: YZHUMGUJCQRKBT-UHFFFAOYSA-M Synonym: sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal PubChem CID: 516902 ChEBI: CHEBI:65242 SMILES: [Na+].[O-][Cl](=O)=O
| PubChem CID | 516902 |
|---|---|
| CAS | 7775-09-9 |
| Molecular Weight (g/mol) | 106.44 |
| ChEBI | CHEBI:65242 |
| MDL Number | MFCD00003479 |
| SMILES | [Na+].[O-][Cl](=O)=O |
| Synonym | sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal |
| InChI Key | YZHUMGUJCQRKBT-UHFFFAOYSA-M |
| Molecular Formula | ClNaO3 |
Sodium pyrophosphate, 98%
CAS: 7722-88-5 Molecular Formula: Na4O7P2 Molecular Weight (g/mol): 265.90 MDL Number: MFCD00003513 InChI Key: FQENQNTWSFEDLI-UHFFFAOYSA-J Synonym: tetrasodium pyrophosphate,sodium pyrophosphate,tspp,phosphotex,tetrasodium diphosphate,diphosphoric acid, tetrasodium salt,sodium diphosphate,victor tspp,natrium pyrophosphat,caswell no. 847 PubChem CID: 24403 ChEBI: CHEBI:71240 IUPAC Name: tetrasodium;phosphonato phosphate SMILES: [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O
| PubChem CID | 24403 |
|---|---|
| CAS | 7722-88-5 |
| Molecular Weight (g/mol) | 265.90 |
| ChEBI | CHEBI:71240 |
| MDL Number | MFCD00003513 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O |
| Synonym | tetrasodium pyrophosphate,sodium pyrophosphate,tspp,phosphotex,tetrasodium diphosphate,diphosphoric acid, tetrasodium salt,sodium diphosphate,victor tspp,natrium pyrophosphat,caswell no. 847 |
| IUPAC Name | tetrasodium;phosphonato phosphate |
| InChI Key | FQENQNTWSFEDLI-UHFFFAOYSA-J |
| Molecular Formula | Na4O7P2 |
Sodium Chloride, Molecular Biology Reagent Grade, MP Biomedicals™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Tungsten(VI) chloride, 99%, 20 mesh
CAS: 13283-01-7 Molecular Formula: Cl6W Molecular Weight (g/mol): 396.57 MDL Number: MFCD00011463 InChI Key: KPGXUAIFQMJJFB-UHFFFAOYSA-H Synonym: tungsten vi chloride,tungsten hexachloride,wolfram hexachloride,wcl6,tungsten chloride wcl6 , oc-6-11,tungsten chloride, oc-6-11,tungsten chloride 8ci,tungsten 6+ hexachloride,wolframhexachlorid,hexachloridotungsten PubChem CID: 83301 ChEBI: CHEBI:37771 IUPAC Name: hexachlorotungsten SMILES: Cl[W](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 83301 |
|---|---|
| CAS | 13283-01-7 |
| Molecular Weight (g/mol) | 396.57 |
| ChEBI | CHEBI:37771 |
| MDL Number | MFCD00011463 |
| SMILES | Cl[W](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | tungsten vi chloride,tungsten hexachloride,wolfram hexachloride,wcl6,tungsten chloride wcl6 , oc-6-11,tungsten chloride, oc-6-11,tungsten chloride 8ci,tungsten 6+ hexachloride,wolframhexachlorid,hexachloridotungsten |
| IUPAC Name | hexachlorotungsten |
| InChI Key | KPGXUAIFQMJJFB-UHFFFAOYSA-H |
| Molecular Formula | Cl6W |
Indium powder, -325 mesh, 99.99% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |
Thermo Scientific Chemicals Potassium permanganate, 99+%, for analysis
CAS: 7722-64-7 Molecular Formula: KMnO4 MDL Number: MFCD00011364 InChI Key: VZJVWSHVAAUDKD-UHFFFAOYSA-N Synonym: potassium permanganate,chameleon mineral,condy's crystals,argucide,cairox,permanganate of potash,insta-perm,walko tablets,algae-k,solo san soo PubChem CID: 516875
| PubChem CID | 516875 |
|---|---|
| CAS | 7722-64-7 |
| MDL Number | MFCD00011364 |
| Synonym | potassium permanganate,chameleon mineral,condy's crystals,argucide,cairox,permanganate of potash,insta-perm,walko tablets,algae-k,solo san soo |
| InChI Key | VZJVWSHVAAUDKD-UHFFFAOYSA-N |
| Molecular Formula | KMnO4 |
Ammonium tetrafluoroborate, 97%
CAS: 13826-83-0 Molecular Formula: BF4H4N Molecular Weight (g/mol): 104.84 MDL Number: MFCD06245785 InChI Key: PDTKOBRZPAIMRD-UHFFFAOYSA-O Synonym: ammonium tetrafluoroborate,ammonium fluoroborate,ammonium fluoborate,ammonium borofluoride,unii-c945z80o8x,ammonium tetrafluroborate,azanium tetrafluoroborate,arnmonium tetrafluoroborate,nh4bf4,ksc492c2p PubChem CID: 9964072 SMILES: [NH4+].F[B-](F)(F)F
| PubChem CID | 9964072 |
|---|---|
| CAS | 13826-83-0 |
| Molecular Weight (g/mol) | 104.84 |
| MDL Number | MFCD06245785 |
| SMILES | [NH4+].F[B-](F)(F)F |
| Synonym | ammonium tetrafluoroborate,ammonium fluoroborate,ammonium fluoborate,ammonium borofluoride,unii-c945z80o8x,ammonium tetrafluroborate,azanium tetrafluoroborate,arnmonium tetrafluoroborate,nh4bf4,ksc492c2p |
| InChI Key | PDTKOBRZPAIMRD-UHFFFAOYSA-O |
| Molecular Formula | BF4H4N |
Copper(II) nitrate hemi(pentahydrate), 98%
CAS: 19004-19-4 Molecular Formula: CuN2O6·2.5H2O MDL Number: MFCD00149671 Synonym: dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate
| CAS | 19004-19-4 |
|---|---|
| MDL Number | MFCD00149671 |
| Synonym | dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate |
| Molecular Formula | CuN2O6·2.5H2O |
Phosphoramidon disodium salt, 97+%, Thermo Scientific Chemicals
CAS: 119942-99-3 Molecular Formula: C23H34N3NaO10P Molecular Weight (g/mol): 566.50 MDL Number: MFCD00077870 InChI Key: KITONROGOABYFZ-UHFFFAOYNA-N Synonym: phosphoramidon disodium salt dihydrate PubChem CID: 129893979 IUPAC Name: (2S)-2-[[(2S)-2-[[hydroxy-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphosphoryl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid;sodium;dihydrate SMILES: [Na].CC(C)CC(NP(O)(=O)OC1OC(C)C(O)C(O)C1O)C(=O)NC(CC1=CNC2=CC=CC=C12)C(O)=O
| PubChem CID | 129893979 |
|---|---|
| CAS | 119942-99-3 |
| Molecular Weight (g/mol) | 566.50 |
| MDL Number | MFCD00077870 |
| SMILES | [Na].CC(C)CC(NP(O)(=O)OC1OC(C)C(O)C(O)C1O)C(=O)NC(CC1=CNC2=CC=CC=C12)C(O)=O |
| Synonym | phosphoramidon disodium salt dihydrate |
| IUPAC Name | (2S)-2-[[(2S)-2-[[hydroxy-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphosphoryl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid;sodium;dihydrate |
| InChI Key | KITONROGOABYFZ-UHFFFAOYNA-N |
| Molecular Formula | C23H34N3NaO10P |
Bismuth powder, -200 mesh, 99.999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |